C18H21N3O — CID 119615030
N-(2-amino-1-cyclopropylethyl)-2-methyl-6-phenylpyridine-3-carboxamide (PubChem CID 119615030) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-2-methyl-6-phenylpyridine-3-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-2-methyl-6-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 119615030 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-2-methyl-6-phenylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)NC(CN)C1CC1 |
| InChI | InChI=1S/C18H21N3O/c1-12-15(18(22)21-17(11-19)14-7-8-14)9-10-16(20-12)13-5-3-2-4-6-13/h2-6,9-10,14,17H,7-8,11,19H2,1H3,(H,21,22) |
| InChIKey | KNFHVMXXGPEHNH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |