C18H27ClN2O — CID 119615242
N-(2-amino-1-cyclopropylethyl)-4-phenylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 119615242) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-phenylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-phenylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119615242 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-phenylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)C1CCC(c2ccccc2)CC1)C1CC1 |
| InChI | InChI=1S/C18H26N2O.ClH/c19-12-17(15-8-9-15)20-18(21)16-10-6-14(7-11-16)13-4-2-1-3-5-13;/h1-5,14-17H,6-12,19H2,(H,20,21);1H |
| InChIKey | ACSVLEZZGPTNRU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |