C10H14N2 — CID 11961606
5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine (PubChem CID 11961606) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine.
| Compound Name | 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 11961606 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
| SMILES | CN1CCCNc2ccccc21 |
| InChI | InChI=1S/C10H14N2/c1-12-8-4-7-11-9-5-2-3-6-10(9)12/h2-3,5-6,11H,4,7-8H2,1H3 |
| InChIKey | QTUHHZFSIDSGRC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |