About methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate
methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate (PubChem CID 11961652) has the molecular formula C17H21NO5
and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate |
| PubChem CID | 11961652 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@H]1O[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO5/c1-10(2)9-12(17(21)22-3)18-16(20)15-14(23-15)13(19)11-7-5-4-6-8-11/h4-8,10,12,14-15H,9H2,1-3H3,(H,18,20)/t12-,14+,15-/m0/s1 |
| InChIKey | FEPJRIFCUNQHKX-CFVMTHIKSA-N |
| XLogP | 1.34 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate?
The IUPAC name of methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate (CID 11961652) is methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate.
What is the SMILES notation for methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate?
The canonical SMILES for methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate is COC(=O)[C@H](CC(C)C)NC(=O)[C@H]1O[C@@H]1C(=O)c1ccccc1.
What is the InChIKey of methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate?
The InChIKey is FEPJRIFCUNQHKX-CFVMTHIKSA-N. The full InChI is InChI=1S/C17H21NO5/c1-10(2)9-12(17(21)22-3)18-16(20)15-14(23-15)13(19)11-7-5-4-6-8-11/h4-8,10,12,14-15H,9H2,1-3H3,(H,18,20)/t12-,14+,15-/m0/s1.
What are the key properties of methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate?
methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate has a molecular weight of 319.36 g/mol, XLogP of 1.34, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[(2S,3S)-3-benzoyloxirane-2-carbonyl]amino]-4-methylpentanoate is sourced from PubChem (CID 11961652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).