C18H28N4O3S — CID 119617620
N-(2-amino-1-cyclopropylethyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 119617620) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 119617620 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)NC(CN)C2CC2)c1 |
| InChI | InChI=1S/C18H28N4O3S/c1-21(2)26(24,25)14-7-8-17(22-9-3-4-10-22)15(11-14)18(23)20-16(12-19)13-5-6-13/h7-8,11,13,16H,3-6,9-10,12,19H2,1-2H3,(H,20,23) |
| InChIKey | ZRBAIKJDRZVLDD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |