C17H19FN2OS — CID 119617905
N-(2-amino-1-cyclopropylethyl)-4-(4-fluorophenyl)-5-methylthiophene-2-carboxamide (PubChem CID 119617905) has the molecular formula C17H19FN2OS and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-(4-fluorophenyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-(4-fluorophenyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119617905 |
| Molecular Formula | C17H19FN2OS |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-(4-fluorophenyl)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NC(CN)C2CC2)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN2OS/c1-10-14(11-4-6-13(18)7-5-11)8-16(22-10)17(21)20-15(9-19)12-2-3-12/h4-8,12,15H,2-3,9,19H2,1H3,(H,20,21) |
| InChIKey | IBUUZSWXQFXBOD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |