About CID 11961792
CID 11961792 (PubChem CID 11961792) has the molecular formula C22H24N
and a molecular weight of 302.44 g/mol.
Molecular Properties
| Compound Name | CID 11961792 |
| PubChem CID | 11961792 |
| Molecular Formula | C22H24N |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)NC([C]1[CH][CH][CH][CH]1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N/c1-21(2,3)23-22(20-16-10-11-17-20,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-17,23H,1-3H3 |
| InChIKey | ULWNOOYBVPEQOL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11961792 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11961792?
The IUPAC name of CID 11961792 (CID 11961792) is not available.
What is the SMILES notation for CID 11961792?
The canonical SMILES for CID 11961792 is CC(C)(C)NC([C]1[CH][CH][CH][CH]1)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 11961792?
The InChIKey is ULWNOOYBVPEQOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N/c1-21(2,3)23-22(20-16-10-11-17-20,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-17,23H,1-3H3.
What are the key properties of CID 11961792?
CID 11961792 has a molecular weight of 302.44 g/mol, XLogP of 4.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11961792 is sourced from PubChem (CID 11961792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).