C21H25NO4S — CID 11961880
methyl (4aS,6R,7R,7aR)-3,6-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-7-carboxylate (PubChem CID 11961880) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is methyl (4aS,6R,7R,7aR)-3,6-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-7-carboxylate.
| Compound Name | methyl (4aS,6R,7R,7aR)-3,6-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 11961880 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl (4aS,6R,7R,7aR)-3,6-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-7-carboxylate |
| SMILES | C=CC1=C[C@@H]2C[C@H](C=C)[C@@H](C(=O)OC)[C@@H]2N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C21H25NO4S/c1-5-15-11-17-12-16(6-2)19(21(23)26-4)20(17)22(13-15)27(24,25)18-9-7-14(3)8-10-18/h5-11,16-17,19-20H,1-2,12-13H2,3-4H3/t16-,17+,19+,20+/m0/s1 |
| InChIKey | IABZIEXOUAETPG-ONCXSQPRSA-N |
| XLogP | 3.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|