C19H18N2O5 — CID 119618941
N-(6-amino-1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropane-1-carboxamide (PubChem CID 119618941) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropane-1-carboxamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119618941 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropane-1-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)C1CC1c1ccc3c(c1)OCCO3)OCO2 |
| InChI | InChI=1S/C19H18N2O5/c20-13-7-17-18(26-9-25-17)8-14(13)21-19(22)12-6-11(12)10-1-2-15-16(5-10)24-4-3-23-15/h1-2,5,7-8,11-12H,3-4,6,9,20H2,(H,21,22) |
| InChIKey | DOKWEUXECCRIRQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|