C18H34ClN3O2 — CID 119619470
2-acetamido-N-[2-(cycloheptylamino)ethyl]-2-cyclopentylacetamide;hydrochloride (PubChem CID 119619470) has the molecular formula C18H34ClN3O2 and a molecular weight of 359.94 g/mol. Its IUPAC name is 2-acetamido-N-[2-(cycloheptylamino)ethyl]-2-cyclopentylacetamide;hydrochloride.
| Compound Name | 2-acetamido-N-[2-(cycloheptylamino)ethyl]-2-cyclopentylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119619470 |
| Molecular Formula | C18H34ClN3O2 |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-acetamido-N-[2-(cycloheptylamino)ethyl]-2-cyclopentylacetamide;hydrochloride |
| SMILES | CC(=O)NC(C(=O)NCCNC1CCCCCC1)C1CCCC1.Cl |
| InChI | InChI=1S/C18H33N3O2.ClH/c1-14(22)21-17(15-8-6-7-9-15)18(23)20-13-12-19-16-10-4-2-3-5-11-16;/h15-17,19H,2-13H2,1H3,(H,20,23)(H,21,22);1H |
| InChIKey | MATDOHBDBPQTLJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|