C19H30Cl2N4O — CID 119619800
3-(benzimidazol-1-yl)-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride (PubChem CID 119619800) has the molecular formula C19H30Cl2N4O and a molecular weight of 401.38 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride.
| Compound Name | 3-(benzimidazol-1-yl)-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119619800 |
| Molecular Formula | C19H30Cl2N4O |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3-(benzimidazol-1-yl)-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCn1cnc2ccccc21)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C19H28N4O.2ClH/c24-19(21-13-12-20-16-7-3-1-2-4-8-16)11-14-23-15-22-17-9-5-6-10-18(17)23;;/h5-6,9-10,15-16,20H,1-4,7-8,11-14H2,(H,21,24);2*1H |
| InChIKey | VOHCMVGUSIKWDJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|