About 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride
2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride (PubChem CID 119619861) has the molecular formula C15H24BrClN4O3
and a molecular weight of 423.74 g/mol. Its IUPAC name is 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride |
| PubChem CID | 119619861 |
| Molecular Formula | C15H24BrClN4O3 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(Cn1cc(Br)c(=O)[nH]c1=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C15H23BrN4O3.ClH/c16-12-9-20(15(23)19-14(12)22)10-13(21)18-8-7-17-11-5-3-1-2-4-6-11;/h9,11,17H,1-8,10H2,(H,18,21)(H,19,22,23);1H |
| InChIKey | WJKOHWAFKJGFNY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride?
The IUPAC name of 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride (CID 119619861) is 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride.
What is the SMILES notation for 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride?
The canonical SMILES for 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride is Cl.O=C(Cn1cc(Br)c(=O)[nH]c1=O)NCCNC1CCCCCC1.
What is the InChIKey of 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride?
The InChIKey is WJKOHWAFKJGFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23BrN4O3.ClH/c16-12-9-20(15(23)19-14(12)22)10-13(21)18-8-7-17-11-5-3-1-2-4-6-11;/h9,11,17H,1-8,10H2,(H,18,21)(H,19,22,23);1H.
What are the key properties of 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride?
2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride has a molecular weight of 423.74 g/mol, XLogP of 1.15, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-2,4-dioxopyrimidin-1-yl)-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride is sourced from PubChem (CID 119619861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).