C21H30Cl3N3O2 — CID 119620079
3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride (PubChem CID 119620079) has the molecular formula C21H30Cl3N3O2 and a molecular weight of 462.85 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride.
| Compound Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119620079 |
| Molecular Formula | C21H30Cl3N3O2 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-[2-(cycloheptylamino)ethyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCc1ncc(-c2ccc(Cl)cc2)o1)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C21H28ClN3O2.2ClH/c22-17-9-7-16(8-10-17)19-15-25-21(27-19)12-11-20(26)24-14-13-23-18-5-3-1-2-4-6-18;;/h7-10,15,18,23H,1-6,11-14H2,(H,24,26);2*1H |
| InChIKey | BSAMHDFRJGYUDO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|