C19H29N5O — CID 119620516
N-[2-(cycloheptylamino)ethyl]-2,5,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 119620516) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2,5,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2,5,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 119620516 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2,5,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C)n2nc(C)c(C(=O)NCCNC3CCCCCC3)c2n1 |
| InChI | InChI=1S/C19H29N5O/c1-13-12-14(2)24-18(22-13)17(15(3)23-24)19(25)21-11-10-20-16-8-6-4-5-7-9-16/h12,16,20H,4-11H2,1-3H3,(H,21,25) |
| InChIKey | OKSRBYOZGWUVQL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|