C19H31ClN6O — CID 119621412
N-[2-(cycloheptylamino)ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide;hydrochloride (PubChem CID 119621412) has the molecular formula C19H31ClN6O and a molecular weight of 394.95 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119621412 |
| Molecular Formula | C19H31ClN6O |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide;hydrochloride |
| SMILES | Cc1nn(C)c(C)c1-c1cc(C(=O)NCCNC2CCCCCC2)[nH]n1.Cl |
| InChI | InChI=1S/C19H30N6O.ClH/c1-13-18(14(2)25(3)24-13)16-12-17(23-22-16)19(26)21-11-10-20-15-8-6-4-5-7-9-15;/h12,15,20H,4-11H2,1-3H3,(H,21,26)(H,22,23);1H |
| InChIKey | LSLVTGWIALNMBG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|