C6H8N4O5 — CID 11962182
(5R,6R,7S,8R)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylic acid (PubChem CID 11962182) has the molecular formula C6H8N4O5 and a molecular weight of 216.15 g/mol. Its IUPAC name is (5R,6R,7S,8R)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylic acid.
| Compound Name | (5R,6R,7S,8R)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 11962182 |
| Molecular Formula | C6H8N4O5 |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (5R,6R,7S,8R)-6,7,8-trihydroxy-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine-5-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@@H](O)[C@H](O)[C@H](O)c2nnnn21 |
| InChI | InChI=1S/C6H8N4O5/c11-2-1(6(14)15)10-5(7-8-9-10)4(13)3(2)12/h1-4,11-13H,(H,14,15)/t1-,2-,3+,4+/m1/s1 |
| InChIKey | JUOIIKUVZVENLR-MMPJQOAZSA-N |
| XLogP | -2.93 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |