C29H27FN6O7 — CID 11962200
2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-5-fluorobenzoic acid (PubChem CID 11962200) has the molecular formula C29H27FN6O7 and a molecular weight of 590.57 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-5-fluorobenzoic acid.
| Compound Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 11962200 |
| Molecular Formula | C29H27FN6O7 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-5-fluorobenzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(COc2ccc(F)cc2C(=O)O)C2O[C@H](/C=C/c3ccccc3)OC21 |
| InChI | InChI=1S/C29H27FN6O7/c1-2-31-29(39)35-25-22-26(33-14-32-25)36(15-34-22)27-24-23(42-21(43-24)11-8-16-6-4-3-5-7-16)20(41-27)13-40-19-10-9-17(30)12-18(19)28(37)38/h3-12,14-15,20-21,23-24,27H,2,13H2,1H3,(H,37,38)(H2,31,32,33,35,39)/b11-8+/t20?,21-,23?,24?,27?/m0/s1 |
| InChIKey | DEEPIAGDBHEPKF-VJAHEZMWSA-N |
| XLogP | 3.60 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |