C19H27N3O3S — CID 119622166
N-cyclopropyl-3-[4-(cyclopropylmethylamino)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 119622166) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-cyclopropyl-3-[4-(cyclopropylmethylamino)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-3-[4-(cyclopropylmethylamino)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119622166 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | N-cyclopropyl-3-[4-(cyclopropylmethylamino)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | O=C(c1cccc(S(=O)(=O)NC2CC2)c1)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C19H27N3O3S/c23-19(22-10-8-16(9-11-22)20-13-14-4-5-14)15-2-1-3-18(12-15)26(24,25)21-17-6-7-17/h1-3,12,14,16-17,20-21H,4-11,13H2 |
| InChIKey | SWMQIEWQFWKWDN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |