C20H37ClN2O — CID 119624610
(4-butylcyclohexyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119624610) has the molecular formula C20H37ClN2O and a molecular weight of 356.98 g/mol. Its IUPAC name is (4-butylcyclohexyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (4-butylcyclohexyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119624610 |
| Molecular Formula | C20H37ClN2O |
| Molecular Weight | 356.98 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (4-butylcyclohexyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CCCCC1CCC(C(=O)N2CCC(NCC3CC3)CC2)CC1.Cl |
| InChI | InChI=1S/C20H36N2O.ClH/c1-2-3-4-16-7-9-18(10-8-16)20(23)22-13-11-19(12-14-22)21-15-17-5-6-17;/h16-19,21H,2-15H2,1H3;1H |
| InChIKey | XGYWENQJMWFBPD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.98 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |