C26H23N5O — CID 11962479
(E)-3-[4-[[4-(4-cyclopropyl-2,6-dimethylphenoxy)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]prop-2-enenitrile (PubChem CID 11962479) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is (E)-3-[4-[[4-(4-cyclopropyl-2,6-dimethylphenoxy)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[[4-(4-cyclopropyl-2,6-dimethylphenoxy)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11962479 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (E)-3-[4-[[4-(4-cyclopropyl-2,6-dimethylphenoxy)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]prop-2-enenitrile |
| SMILES | Cc1cc(C2CC2)cc(C)c1Oc1nc(Nc2ccc(/C=C/C#N)cc2)nc2cc[nH]c12 |
| InChI | InChI=1S/C26H23N5O/c1-16-14-20(19-7-8-19)15-17(2)24(16)32-25-23-22(11-13-28-23)30-26(31-25)29-21-9-5-18(6-10-21)4-3-12-27/h3-6,9-11,13-15,19,28H,7-8H2,1-2H3,(H,29,30,31)/b4-3+ |
| InChIKey | VZMRTRWJQJUYEB-ONEGZZNKSA-N |
| XLogP | 6.52 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|