C17H24ClIN2O — CID 119625200
[4-(cyclopropylmethylamino)piperidin-1-yl]-(3-iodo-4-methylphenyl)methanone;hydrochloride (PubChem CID 119625200) has the molecular formula C17H24ClIN2O and a molecular weight of 434.75 g/mol. Its IUPAC name is [4-(cyclopropylmethylamino)piperidin-1-yl]-(3-iodo-4-methylphenyl)methanone;hydrochloride.
| Compound Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(3-iodo-4-methylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119625200 |
| Molecular Formula | C17H24ClIN2O |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(3-iodo-4-methylphenyl)methanone;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCC(NCC3CC3)CC2)cc1I.Cl |
| InChI | InChI=1S/C17H23IN2O.ClH/c1-12-2-5-14(10-16(12)18)17(21)20-8-6-15(7-9-20)19-11-13-3-4-13;/h2,5,10,13,15,19H,3-4,6-9,11H2,1H3;1H |
| InChIKey | IMBMHJSIAUBJHV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|