C27H26N8O7 — CID 11962543
2-[[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]methyl]pyridine-3-carboxylic acid (PubChem CID 11962543) has the molecular formula C27H26N8O7 and a molecular weight of 574.55 g/mol. Its IUPAC name is 2-[[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]methyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11962543 |
| Molecular Formula | C27H26N8O7 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 2-[[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]methyl]pyridine-3-carboxylic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(C(=O)NCc2ncccc2C(=O)O)C2O[C@H](c3ccccc3)OC21 |
| InChI | InChI=1S/C27H26N8O7/c1-2-28-27(39)34-21-17-22(32-12-31-21)35(13-33-17)24-20-18(41-26(42-20)14-7-4-3-5-8-14)19(40-24)23(36)30-11-16-15(25(37)38)9-6-10-29-16/h3-10,12-13,18-20,24,26H,2,11H2,1H3,(H,30,36)(H,37,38)(H2,28,31,32,34,39)/t18?,19?,20?,24?,26-/m0/s1 |
| InChIKey | VZVKTSQGESPGLF-GBGNLSQLSA-N |
| XLogP | 1.76 |
| TPSA | 191.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |