About 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid
3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid (PubChem CID 11962553) has the molecular formula C19H20F2O5S
and a molecular weight of 398.43 g/mol. Its IUPAC name is 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid |
| PubChem CID | 11962553 |
| Molecular Formula | C19H20F2O5S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid |
| SMILES | Cc1c(S(=O)(=O)Cc2cccc(F)c2F)cc(C(C)(C)C)c(O)c1C(=O)O |
| InChI | InChI=1S/C19H20F2O5S/c1-10-14(8-12(19(2,3)4)17(22)15(10)18(23)24)27(25,26)9-11-6-5-7-13(20)16(11)21/h5-8,22H,9H2,1-4H3,(H,23,24) |
| InChIKey | SYGPFIAUMIDVSZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid?
The IUPAC name of 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid (CID 11962553) is 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid.
What is the SMILES notation for 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid?
The canonical SMILES for 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid is Cc1c(S(=O)(=O)Cc2cccc(F)c2F)cc(C(C)(C)C)c(O)c1C(=O)O.
What is the InChIKey of 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid?
The InChIKey is SYGPFIAUMIDVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2O5S/c1-10-14(8-12(19(2,3)4)17(22)15(10)18(23)24)27(25,26)9-11-6-5-7-13(20)16(11)21/h5-8,22H,9H2,1-4H3,(H,23,24).
What are the key properties of 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid?
3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid has a molecular weight of 398.43 g/mol, XLogP of 3.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-[(2,3-difluorophenyl)methylsulfonyl]-2-hydroxy-6-methylbenzoic acid is sourced from PubChem (CID 11962553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).