C12H19ClN2O — CID 119625603
N-[4-(1-aminoethyl)phenyl]butanamide;hydrochloride (PubChem CID 119625603) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)phenyl]butanamide;hydrochloride.
| Compound Name | N-[4-(1-aminoethyl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119625603 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[4-(1-aminoethyl)phenyl]butanamide;hydrochloride |
| SMILES | CCCC(=O)Nc1ccc(C(C)N)cc1.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-3-4-12(15)14-11-7-5-10(6-8-11)9(2)13;/h5-9H,3-4,13H2,1-2H3,(H,14,15);1H |
| InChIKey | FXAJOMMQMLHPIT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |