About 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid
5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid (PubChem CID 11962603) has the molecular formula C20H18F6O5S
and a molecular weight of 484.41 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid |
| PubChem CID | 11962603 |
| Molecular Formula | C20H18F6O5S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid |
| SMILES | Cc1c(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(C)(C)C)c(O)c1C(=O)O |
| InChI | InChI=1S/C20H18F6O5S/c1-9-14(8-13(18(2,3)4)16(27)15(9)17(28)29)32(30,31)12-6-10(19(21,22)23)5-11(7-12)20(24,25)26/h5-8,27H,1-4H3,(H,28,29) |
| InChIKey | BTWFYCXMDVYONR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid (CID 11962603) is 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid is Cc1c(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(C)(C)C)c(O)c1C(=O)O.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid?
The InChIKey is BTWFYCXMDVYONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F6O5S/c1-9-14(8-13(18(2,3)4)16(27)15(9)17(28)29)32(30,31)12-6-10(19(21,22)23)5-11(7-12)20(24,25)26/h5-8,27H,1-4H3,(H,28,29).
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid?
5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid has a molecular weight of 484.41 g/mol, XLogP of 5.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-3-tert-butyl-2-hydroxy-6-methylbenzoic acid is sourced from PubChem (CID 11962603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).