C13H19Cl2N5O — CID 119626185
N-(2-amino-2-methylpropyl)-4-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride (PubChem CID 119626185) has the molecular formula C13H19Cl2N5O and a molecular weight of 332.24 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-4-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119626185 |
| Molecular Formula | C13H19Cl2N5O |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-pyrazol-1-ylpyridine-2-carboxamide;dihydrochloride |
| SMILES | CC(C)(N)CNC(=O)c1cc(-n2cccn2)ccn1.Cl.Cl |
| InChI | InChI=1S/C13H17N5O.2ClH/c1-13(2,14)9-16-12(19)11-8-10(4-6-15-11)18-7-3-5-17-18;;/h3-8H,9,14H2,1-2H3,(H,16,19);2*1H |
| InChIKey | PZYMLNZSTZCGHL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |