C26H24N8O7 — CID 11962629
2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]pyridine-3-carboxylic acid (PubChem CID 11962629) has the molecular formula C26H24N8O7 and a molecular weight of 560.53 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11962629 |
| Molecular Formula | C26H24N8O7 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]pyridine-3-carboxylic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(C(=O)Nc2ncccc2C(=O)O)C2O[C@H](c3ccccc3)OC21 |
| InChI | InChI=1S/C26H24N8O7/c1-2-27-26(38)33-20-15-21(30-11-29-20)34(12-31-15)23-18-16(40-25(41-18)13-7-4-3-5-8-13)17(39-23)22(35)32-19-14(24(36)37)9-6-10-28-19/h3-12,16-18,23,25H,2H2,1H3,(H,36,37)(H,28,32,35)(H2,27,29,30,33,38)/t16?,17?,18?,23?,25-/m0/s1 |
| InChIKey | HPYXPFIPPHKNMX-HXPBADDVSA-N |
| XLogP | 2.08 |
| TPSA | 191.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |