C27H26ClN5O3 — CID 11962652
(E)-3-[4-[2-(4-chloroanilino)-5,7-diethylpyrrolo[3,2-d]pyrimidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enenitrile (PubChem CID 11962652) has the molecular formula C27H26ClN5O3 and a molecular weight of 503.99 g/mol. Its IUPAC name is (E)-3-[4-[2-(4-chloroanilino)-5,7-diethylpyrrolo[3,2-d]pyrimidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[2-(4-chloroanilino)-5,7-diethylpyrrolo[3,2-d]pyrimidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11962652 |
| Molecular Formula | C27H26ClN5O3 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (E)-3-[4-[2-(4-chloroanilino)-5,7-diethylpyrrolo[3,2-d]pyrimidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enenitrile |
| SMILES | CCc1cn(CC)c2c(Oc3c(OC)cc(/C=C/C#N)cc3OC)nc(Nc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C27H26ClN5O3/c1-5-18-16-33(6-2)24-23(18)31-27(30-20-11-9-19(28)10-12-20)32-26(24)36-25-21(34-3)14-17(8-7-13-29)15-22(25)35-4/h7-12,14-16H,5-6H2,1-4H3,(H,30,31,32)/b8-7+ |
| InChIKey | FYQVQRDVKPIYTG-BQYQJAHWSA-N |
| XLogP | 6.76 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|