C20H22N2O5 — CID 11962813
3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)-1-pentylpyrrolo[3,2-b]pyridin-2-one (PubChem CID 11962813) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)-1-pentylpyrrolo[3,2-b]pyridin-2-one.
| Compound Name | 3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)-1-pentylpyrrolo[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 11962813 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)-1-pentylpyrrolo[3,2-b]pyridin-2-one |
| SMILES | CCCCCN1C(=O)C(CO)(c2cc3c(cc2O)OCO3)c2ncccc21 |
| InChI | InChI=1S/C20H22N2O5/c1-2-3-4-8-22-14-6-5-7-21-18(14)20(11-23,19(22)25)13-9-16-17(10-15(13)24)27-12-26-16/h5-7,9-10,23-24H,2-4,8,11-12H2,1H3 |
| InChIKey | VTFDUQVCOBBJSB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|