C12H19ClN4O3S — CID 119630347
N-(2-amino-2-methylpropyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride (PubChem CID 119630347) has the molecular formula C12H19ClN4O3S and a molecular weight of 334.83 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119630347 |
| Molecular Formula | C12H19ClN4O3S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride |
| SMILES | CC(C)(N)CNC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1.Cl |
| InChI | InChI=1S/C12H18N4O3S.ClH/c1-12(2,13)8-14-11(17)9-3-4-10-15-20(18,19)6-5-16(10)7-9;/h3-4,7H,5-6,8,13H2,1-2H3,(H,14,17);1H |
| InChIKey | NJLYBSKSSXGHLS-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |