C18H27N3O3S — CID 119632759
5-[2-(aminomethyl)pyrrolidine-1-carbonyl]-N-cyclopentyl-2-methylbenzenesulfonamide (PubChem CID 119632759) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 5-[2-(aminomethyl)pyrrolidine-1-carbonyl]-N-cyclopentyl-2-methylbenzenesulfonamide.
| Compound Name | 5-[2-(aminomethyl)pyrrolidine-1-carbonyl]-N-cyclopentyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119632759 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 5-[2-(aminomethyl)pyrrolidine-1-carbonyl]-N-cyclopentyl-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCCC2CN)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H27N3O3S/c1-13-8-9-14(18(22)21-10-4-7-16(21)12-19)11-17(13)25(23,24)20-15-5-2-3-6-15/h8-9,11,15-16,20H,2-7,10,12,19H2,1H3 |
| InChIKey | UKSJDNJBXNQXTJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |