C12H15BrClN3O3 — CID 119632797
[2-(aminomethyl)pyrrolidin-1-yl]-(2-bromo-4-nitrophenyl)methanone;hydrochloride (PubChem CID 119632797) has the molecular formula C12H15BrClN3O3 and a molecular weight of 364.63 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(2-bromo-4-nitrophenyl)methanone;hydrochloride.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(2-bromo-4-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119632797 |
| Molecular Formula | C12H15BrClN3O3 |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(2-bromo-4-nitrophenyl)methanone;hydrochloride |
| SMILES | Cl.NCC1CCCN1C(=O)c1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C12H14BrN3O3.ClH/c13-11-6-8(16(18)19)3-4-10(11)12(17)15-5-1-2-9(15)7-14;/h3-4,6,9H,1-2,5,7,14H2;1H |
| InChIKey | LACTUBARZVLWSR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|