C13H13N3O3S — CID 11963472
N-(3-acetylphenyl)-2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetamide (PubChem CID 11963472) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-(3-acetylphenyl)-2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 11963472 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-(3-acetylphenyl)-2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC2SC(N)=NC2=O)c1 |
| InChI | InChI=1S/C13H13N3O3S/c1-7(17)8-3-2-4-9(5-8)15-11(18)6-10-12(19)16-13(14)20-10/h2-5,10H,6H2,1H3,(H,15,18)(H2,14,16,19) |
| InChIKey | ITNDSMYZXQXMGH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |