C33H32N2O3 — CID 11963503
N-[(2S,3R)-3-hydroxy-4-[(3-methylphenyl)methylamino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide (PubChem CID 11963503) has the molecular formula C33H32N2O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-[(3-methylphenyl)methylamino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-[(3-methylphenyl)methylamino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide |
|---|---|
| PubChem CID | 11963503 |
| Molecular Formula | C33H32N2O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-[(3-methylphenyl)methylamino]-1-phenylbutan-2-yl]benzo[b][1]benzoxepine-5-carboxamide |
| SMILES | Cc1cccc(CNC[C@@H](O)[C@H](Cc2ccccc2)NC(=O)C2=Cc3ccccc3Oc3ccccc32)c1 |
| InChI | InChI=1S/C33H32N2O3/c1-23-10-9-13-25(18-23)21-34-22-30(36)29(19-24-11-3-2-4-12-24)35-33(37)28-20-26-14-5-7-16-31(26)38-32-17-8-6-15-27(28)32/h2-18,20,29-30,34,36H,19,21-22H2,1H3,(H,35,37)/t29-,30+/m0/s1 |
| InChIKey | BNWZCXDHHPBQOX-XZWHSSHBSA-N |
| XLogP | 5.52 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|