C13H20ClN5O3 — CID 119636443
1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-(2-methyl-4-nitroimidazol-1-yl)ethanone;hydrochloride (PubChem CID 119636443) has the molecular formula C13H20ClN5O3 and a molecular weight of 329.79 g/mol. Its IUPAC name is 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-(2-methyl-4-nitroimidazol-1-yl)ethanone;hydrochloride.
| Compound Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-(2-methyl-4-nitroimidazol-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119636443 |
| Molecular Formula | C13H20ClN5O3 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-(2-methyl-4-nitroimidazol-1-yl)ethanone;hydrochloride |
| SMILES | Cc1nc([N+](=O)[O-])cn1CC(=O)N1CCC2CCC(C1)N2.Cl |
| InChI | InChI=1S/C13H19N5O3.ClH/c1-9-14-12(18(20)21)7-17(9)8-13(19)16-5-4-10-2-3-11(6-16)15-10;/h7,10-11,15H,2-6,8H2,1H3;1H |
| InChIKey | WLODOTZVSJBOIL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|