C23H48FeN2Si2+2 — CID 11963882
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;iron(4+);bis(methanidyl(trimethyl)silane) (PubChem CID 11963882) has the molecular formula C23H48FeN2Si2+2 and a molecular weight of 464.67 g/mol. Its IUPAC name is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;iron(4+);bis(methanidyl(trimethyl)silane).
| Compound Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;iron(4+);bis(methanidyl(trimethyl)silane) |
|---|---|
| PubChem CID | 11963882 |
| Molecular Formula | C23H48FeN2Si2+2 |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;iron(4+);bis(methanidyl(trimethyl)silane) |
| SMILES | C1CCN2CC3CC(CN4CCCCC34)C2C1.[CH2-][Si](C)(C)C.[CH2-][Si](C)(C)C.[Fe+4] |
| InChI | InChI=1S/C15H26N2.2C4H11Si.Fe/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17;2*1-5(2,3)4;/h12-15H,1-11H2;2*1H2,2-4H3;/q;2*-1;+4 |
| InChIKey | HEOPHQROTNTPGU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|