C28H31Cl2N9 — CID 11963952
2-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-1-phenylguanidine (PubChem CID 11963952) has the molecular formula C28H31Cl2N9 and a molecular weight of 564.53 g/mol. Its IUPAC name is 2-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-1-phenylguanidine.
| Compound Name | 2-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-1-phenylguanidine |
|---|---|
| PubChem CID | 11963952 |
| Molecular Formula | C28H31Cl2N9 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 2-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-1-phenylguanidine |
| SMILES | CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(/N=C(\N)Nc4ccccc4)nc3n2)CC1 |
| InChI | InChI=1S/C28H31Cl2N9/c1-38-13-15-39(16-14-38)12-6-11-32-28-33-18-19-17-21(24-22(29)9-5-10-23(24)30)26(35-25(19)37-28)36-27(31)34-20-7-3-2-4-8-20/h2-5,7-10,17-18H,6,11-16H2,1H3,(H4,31,32,33,34,35,36,37) |
| InChIKey | CYXWKNGEVVRUQT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|