C15H25ClN2O2 — CID 119639628
N-(2-amino-2-ethylbutyl)-2-(3-methoxyphenyl)acetamide;hydrochloride (PubChem CID 119639628) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-(3-methoxyphenyl)acetamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-(3-methoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119639628 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-(3-methoxyphenyl)acetamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)Cc1cccc(OC)c1.Cl |
| InChI | InChI=1S/C15H24N2O2.ClH/c1-4-15(16,5-2)11-17-14(18)10-12-7-6-8-13(9-12)19-3;/h6-9H,4-5,10-11,16H2,1-3H3,(H,17,18);1H |
| InChIKey | BYRBSMUHZRVFNZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |