About methanolate;tributylstannanylium
methanolate;tributylstannanylium (PubChem CID 11964040) has the molecular formula C13H30OSn
and a molecular weight of 321.09 g/mol. Its IUPAC name is methanolate;tributylstannanylium.
Molecular Properties
| Compound Name | methanolate;tributylstannanylium |
| PubChem CID | 11964040 |
| Molecular Formula | C13H30OSn |
| Molecular Weight | 321.09 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | methanolate;tributylstannanylium |
| SMILES | CCCC[Sn+](CCCC)CCCC.C[O-] |
| InChI | InChI=1S/3C4H9.CH3O.Sn/c3*1-3-4-2;1-2;/h3*1,3-4H2,2H3;1H3;/q;;;-1;+1 |
| InChIKey | KJGLZJQPMKQFIK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.09 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methanolate;tributylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanolate;tributylstannanylium?
The IUPAC name of methanolate;tributylstannanylium (CID 11964040) is methanolate;tributylstannanylium.
What is the SMILES notation for methanolate;tributylstannanylium?
The canonical SMILES for methanolate;tributylstannanylium is CCCC[Sn+](CCCC)CCCC.C[O-].
What is the InChIKey of methanolate;tributylstannanylium?
The InChIKey is KJGLZJQPMKQFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.CH3O.Sn/c3*1-3-4-2;1-2;/h3*1,3-4H2,2H3;1H3;/q;;;-1;+1.
What are the key properties of methanolate;tributylstannanylium?
methanolate;tributylstannanylium has a molecular weight of 321.09 g/mol, XLogP of 3.86, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanolate;tributylstannanylium is sourced from PubChem (CID 11964040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).