C14H23F9N2 — CID 11964059
N,N-diethyl-1,1,3,3,3-pentafluoropropan-1-amine;(Z)-N,N-diethyl-1,3,3,3-tetrafluoroprop-1-en-1-amine (PubChem CID 11964059) has the molecular formula C14H23F9N2 and a molecular weight of 390.33 g/mol. Its IUPAC name is N,N-diethyl-1,1,3,3,3-pentafluoropropan-1-amine;(Z)-N,N-diethyl-1,3,3,3-tetrafluoroprop-1-en-1-amine.
| Compound Name | N,N-diethyl-1,1,3,3,3-pentafluoropropan-1-amine;(Z)-N,N-diethyl-1,3,3,3-tetrafluoroprop-1-en-1-amine |
|---|---|
| PubChem CID | 11964059 |
| Molecular Formula | C14H23F9N2 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N,N-diethyl-1,1,3,3,3-pentafluoropropan-1-amine;(Z)-N,N-diethyl-1,3,3,3-tetrafluoroprop-1-en-1-amine |
| SMILES | CCN(CC)/C(F)=C/C(F)(F)F.CCN(CC)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C7H12F5N.C7H11F4N/c1-3-13(4-2)7(11,12)5-6(8,9)10;1-3-12(4-2)6(8)5-7(9,10)11/h3-5H2,1-2H3;5H,3-4H2,1-2H3/b;6-5+ |
| InChIKey | ZSQYCNSYQUHNJX-MXDQRGINSA-N |
| XLogP | 5.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|