C12H21ClN2O2 — CID 119640929
N-(2-amino-2-ethylbutyl)-2-methylfuran-3-carboxamide;hydrochloride (PubChem CID 119640929) has the molecular formula C12H21ClN2O2 and a molecular weight of 260.76 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-methylfuran-3-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-methylfuran-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119640929 |
| Molecular Formula | C12H21ClN2O2 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-methylfuran-3-carboxamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1ccoc1C.Cl |
| InChI | InChI=1S/C12H20N2O2.ClH/c1-4-12(13,5-2)8-14-11(15)10-6-7-16-9(10)3;/h6-7H,4-5,8,13H2,1-3H3,(H,14,15);1H |
| InChIKey | SEBYNXOMJKHSIV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |