C16H23Cl2N3O — CID 119641919
N-(2-amino-2-ethylbutyl)quinoline-8-carboxamide;dihydrochloride (PubChem CID 119641919) has the molecular formula C16H23Cl2N3O and a molecular weight of 344.29 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)quinoline-8-carboxamide;dihydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)quinoline-8-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119641919 |
| Molecular Formula | C16H23Cl2N3O |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)quinoline-8-carboxamide;dihydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1cccc2cccnc12.Cl.Cl |
| InChI | InChI=1S/C16H21N3O.2ClH/c1-3-16(17,4-2)11-19-15(20)13-9-5-7-12-8-6-10-18-14(12)13;;/h5-10H,3-4,11,17H2,1-2H3,(H,19,20);2*1H |
| InChIKey | JABHQVMXZPHCSH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |