C20H18F3N3O — CID 11964241
1-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]-5,6,7,8-tetrahydronaphthalene-1,7-diamine (PubChem CID 11964241) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]-5,6,7,8-tetrahydronaphthalene-1,7-diamine.
| Compound Name | 1-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]-5,6,7,8-tetrahydronaphthalene-1,7-diamine |
|---|---|
| PubChem CID | 11964241 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-N-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]-5,6,7,8-tetrahydronaphthalene-1,7-diamine |
| SMILES | NC1CCc2cccc(Nc3ncc(-c4ccc(C(F)(F)F)cc4)o3)c2C1 |
| InChI | InChI=1S/C20H18F3N3O/c21-20(22,23)14-7-4-13(5-8-14)18-11-25-19(27-18)26-17-3-1-2-12-6-9-15(24)10-16(12)17/h1-5,7-8,11,15H,6,9-10,24H2,(H,25,26) |
| InChIKey | CAZPUPYLGDBILQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |