About (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid
(2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 11964323) has the molecular formula C14H23N3O3S2
and a molecular weight of 345.49 g/mol. Its IUPAC name is (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| PubChem CID | 11964323 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | O=C(CCCCC(S)CCS)N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C14H23N3O3S2/c18-13(4-2-1-3-11(22)5-6-21)17-12(14(19)20)7-10-8-15-9-16-10/h8-9,11-12,21-22H,1-7H2,(H,15,16)(H,17,18)(H,19,20)/t11?,12-/m0/s1 |
| InChIKey | VDWQLXDLGJSQDR-KIYNQFGBSA-N |
| XLogP | 1.70 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid?
The IUPAC name of (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (CID 11964323) is (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
What is the SMILES notation for (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid?
The canonical SMILES for (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid is O=C(CCCCC(S)CCS)N[C@@H](Cc1cnc[nH]1)C(=O)O.
What is the InChIKey of (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid?
The InChIKey is VDWQLXDLGJSQDR-KIYNQFGBSA-N. The full InChI is InChI=1S/C14H23N3O3S2/c18-13(4-2-1-3-11(22)5-6-21)17-12(14(19)20)7-10-8-15-9-16-10/h8-9,11-12,21-22H,1-7H2,(H,15,16)(H,17,18)(H,19,20)/t11?,12-/m0/s1.
What are the key properties of (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid?
(2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid has a molecular weight of 345.49 g/mol, XLogP of 1.70, 11 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-(1H-imidazol-5-yl)propanoic acid is sourced from PubChem (CID 11964323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).