About 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine
2-(4-fluorophenyl)-1,3-benzothiazol-6-amine (PubChem CID 11964482) has the molecular formula C13H9FN2S
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine |
| PubChem CID | 11964482 |
| Molecular Formula | C13H9FN2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(-c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C13H9FN2S/c14-9-3-1-8(2-4-9)13-16-11-6-5-10(15)7-12(11)17-13/h1-7H,15H2 |
| InChIKey | NTKYDIXDAVHHLS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine?
The IUPAC name of 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine (CID 11964482) is 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine is Nc1ccc2nc(-c3ccc(F)cc3)sc2c1.
What is the InChIKey of 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine?
The InChIKey is NTKYDIXDAVHHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FN2S/c14-9-3-1-8(2-4-9)13-16-11-6-5-10(15)7-12(11)17-13/h1-7H,15H2.
What are the key properties of 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine?
2-(4-fluorophenyl)-1,3-benzothiazol-6-amine has a molecular weight of 244.29 g/mol, XLogP of 3.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-1,3-benzothiazol-6-amine is sourced from PubChem (CID 11964482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).