C21H34N2O — CID 119645141
1-[4-(ethylaminomethyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)butan-1-one (PubChem CID 119645141) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)butan-1-one.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 119645141 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)butan-1-one |
| SMILES | CCNCC1CCN(C(=O)CC(C)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H34N2O/c1-5-22-15-18-10-12-23(13-11-18)21(24)14-17(4)20-8-6-19(7-9-20)16(2)3/h6-9,16-18,22H,5,10-15H2,1-4H3 |
| InChIKey | GFAWRABNPJXWBX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |