C27H38N4O6 — CID 11964530
(3S,9S,12R)-3-benzyl-9-(7-hydroxy-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 11964530) has the molecular formula C27H38N4O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is (3S,9S,12R)-3-benzyl-9-(7-hydroxy-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,9S,12R)-3-benzyl-9-(7-hydroxy-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 11964530 |
| Molecular Formula | C27H38N4O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (3S,9S,12R)-3-benzyl-9-(7-hydroxy-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC1(C)NC(=O)[C@H](CCCCCC(=O)CO)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C27H38N4O6/c1-27(2)26(37)29-21(16-18-10-5-3-6-11-18)25(36)31-15-9-14-22(31)24(35)28-20(23(34)30-27)13-8-4-7-12-19(33)17-32/h3,5-6,10-11,20-22,32H,4,7-9,12-17H2,1-2H3,(H,28,35)(H,29,37)(H,30,34)/t20-,21-,22+/m0/s1 |
| InChIKey | XXRCTSZBEZSWSN-FDFHNCONSA-N |
| XLogP | 0.61 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|