C20H22N2O3 — CID 11964544
benzyl (4aS,9bR)-8-methoxy-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate (PubChem CID 11964544) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is benzyl (4aS,9bR)-8-methoxy-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate.
| Compound Name | benzyl (4aS,9bR)-8-methoxy-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 11964544 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | benzyl (4aS,9bR)-8-methoxy-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
| SMILES | COc1ccc2c(c1)[C@@H]1CN(C(=O)OCc3ccccc3)CC[C@@H]1N2 |
| InChI | InChI=1S/C20H22N2O3/c1-24-15-7-8-18-16(11-15)17-12-22(10-9-19(17)21-18)20(23)25-13-14-5-3-2-4-6-14/h2-8,11,17,19,21H,9-10,12-13H2,1H3/t17-,19-/m0/s1 |
| InChIKey | FBIJKDXLMZAAFW-HKUYNNGSSA-N |
| XLogP | 3.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|