C12H21ClN4O — CID 119645537
[4-(ethylaminomethyl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone;hydrochloride (PubChem CID 119645537) has the molecular formula C12H21ClN4O and a molecular weight of 272.78 g/mol. Its IUPAC name is [4-(ethylaminomethyl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone;hydrochloride.
| Compound Name | [4-(ethylaminomethyl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119645537 |
| Molecular Formula | C12H21ClN4O |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [4-(ethylaminomethyl)piperidin-1-yl]-(1H-pyrazol-5-yl)methanone;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)c2ccn[nH]2)CC1.Cl |
| InChI | InChI=1S/C12H20N4O.ClH/c1-2-13-9-10-4-7-16(8-5-10)12(17)11-3-6-14-15-11;/h3,6,10,13H,2,4-5,7-9H2,1H3,(H,14,15);1H |
| InChIKey | GYWDQHCFLOGMRY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |