C23H28ClN7O3S — CID 11964555
N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-1-prop-2-enylpiperidin-4-yl]oxamide (PubChem CID 11964555) has the molecular formula C23H28ClN7O3S and a molecular weight of 518.04 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-1-prop-2-enylpiperidin-4-yl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-1-prop-2-enylpiperidin-4-yl]oxamide |
|---|---|
| PubChem CID | 11964555 |
| Molecular Formula | C23H28ClN7O3S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(3R,4S)-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-1-prop-2-enylpiperidin-4-yl]oxamide |
| SMILES | C=CCN1CC[C@H](NC(=O)C(=O)Nc2ccc(Cl)cn2)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C23H28ClN7O3S/c1-3-8-31-10-7-15(26-20(32)21(33)29-19-5-4-14(24)11-25-19)17(12-31)27-22(34)23-28-16-6-9-30(2)13-18(16)35-23/h3-5,11,15,17H,1,6-10,12-13H2,2H3,(H,26,32)(H,27,34)(H,25,29,33)/t15-,17+/m0/s1 |
| InChIKey | KFWVMJUHBOJCHH-DOTOQJQBSA-N |
| XLogP | 1.29 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|